C35H51N5O3S — CID 90068663
2-ethylhexyl 2-[[2-acetamido-4-[ethyl(2-ethylhexyl)amino]-5-methylphenyl]diazenyl]-1,3-benzothiazole-6-carboxylate (PubChem CID 90068663) has the molecular formula C35H51N5O3S and a molecular weight of 621.89 g/mol. Its IUPAC name is 2-ethylhexyl 2-[[2-acetamido-4-[ethyl(2-ethylhexyl)amino]-5-methylphenyl]diazenyl]-1,3-benzothiazole-6-carboxylate.
| Compound Name | 2-ethylhexyl 2-[[2-acetamido-4-[ethyl(2-ethylhexyl)amino]-5-methylphenyl]diazenyl]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 90068663 |
| Molecular Formula | C35H51N5O3S |
| Molecular Weight | 621.89 g/mol |
| Exact Mass | 621.37 |
| IUPAC Name | 2-ethylhexyl 2-[[2-acetamido-4-[ethyl(2-ethylhexyl)amino]-5-methylphenyl]diazenyl]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCC(CC)COC(=O)c1ccc2nc(/N=N/c3cc(C)c(N(CC)CC(CC)CCCC)cc3NC(C)=O)sc2c1 |
| InChI | InChI=1S/C35H51N5O3S/c1-8-13-15-26(10-3)22-40(12-5)32-21-30(36-25(7)41)31(19-24(32)6)38-39-35-37-29-18-17-28(20-33(29)44-35)34(42)43-23-27(11-4)16-14-9-2/h17-21,26-27H,8-16,22-23H2,1-7H3,(H,36,41)/b39-38+ |
| InChIKey | IIEFMZYRHQUDHV-YMZYAJTMSA-N |
| XLogP | 10.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.89 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|