C35H55N5O3S — CID 144565091
2-ethylbutyl 4-(methylideneamino)-3-methylsulfanylbenzoate;N-[5-[ethyl(2-ethylhexyl)amino]-4-methyl-2-(methyldiazenyl)phenyl]acetamide (PubChem CID 144565091) has the molecular formula C35H55N5O3S and a molecular weight of 625.92 g/mol. Its IUPAC name is 2-ethylbutyl 4-(methylideneamino)-3-methylsulfanylbenzoate;N-[5-[ethyl(2-ethylhexyl)amino]-4-methyl-2-(methyldiazenyl)phenyl]acetamide.
| Compound Name | 2-ethylbutyl 4-(methylideneamino)-3-methylsulfanylbenzoate;N-[5-[ethyl(2-ethylhexyl)amino]-4-methyl-2-(methyldiazenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 144565091 |
| Molecular Formula | C35H55N5O3S |
| Molecular Weight | 625.92 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | 2-ethylbutyl 4-(methylideneamino)-3-methylsulfanylbenzoate;N-[5-[ethyl(2-ethylhexyl)amino]-4-methyl-2-(methyldiazenyl)phenyl]acetamide |
| SMILES | C=Nc1ccc(C(=O)OCC(CC)CC)cc1SC.CCCCC(CC)CN(CC)c1cc(NC(C)=O)c(/N=N/C)cc1C |
| InChI | InChI=1S/C20H34N4O.C15H21NO2S/c1-7-10-11-17(8-2)14-24(9-3)20-13-18(22-16(5)25)19(23-21-6)12-15(20)4;1-5-11(6-2)10-18-15(17)12-7-8-13(16-3)14(9-12)19-4/h12-13,17H,7-11,14H2,1-6H3,(H,22,25);7-9,11H,3,5-6,10H2,1-2,4H3/b23-21+; |
| InChIKey | LEOJJYQGFUYTGL-FKWCIMQXSA-N |
| XLogP | 10.04 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.92 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|