C25H32ClN5OS — CID 118218124
N-[2-[(6-chloro-1,3-benzothiazol-2-yl)diazenyl]-5-[ethyl(2-methylhexyl)amino]-4-methylphenyl]acetamide (PubChem CID 118218124) has the molecular formula C25H32ClN5OS and a molecular weight of 486.09 g/mol. Its IUPAC name is N-[2-[(6-chloro-1,3-benzothiazol-2-yl)diazenyl]-5-[ethyl(2-methylhexyl)amino]-4-methylphenyl]acetamide.
| Compound Name | N-[2-[(6-chloro-1,3-benzothiazol-2-yl)diazenyl]-5-[ethyl(2-methylhexyl)amino]-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 118218124 |
| Molecular Formula | C25H32ClN5OS |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[2-[(6-chloro-1,3-benzothiazol-2-yl)diazenyl]-5-[ethyl(2-methylhexyl)amino]-4-methylphenyl]acetamide |
| SMILES | CCCCC(C)CN(CC)c1cc(NC(C)=O)c(/N=N/c2nc3ccc(Cl)cc3s2)cc1C |
| InChI | InChI=1S/C25H32ClN5OS/c1-6-8-9-16(3)15-31(7-2)23-14-21(27-18(5)32)22(12-17(23)4)29-30-25-28-20-11-10-19(26)13-24(20)33-25/h10-14,16H,6-9,15H2,1-5H3,(H,27,32)/b30-29+ |
| InChIKey | SGBKBVLLLFWTLV-QVIHXGFCSA-N |
| XLogP | 8.28 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|