C20H23BrN4S — CID 18737351
4-[(6-bromo-1,3-benzothiazol-2-yl)diazenyl]-3-methyl-N,N-dipropylaniline (PubChem CID 18737351) has the molecular formula C20H23BrN4S and a molecular weight of 431.40 g/mol. Its IUPAC name is 4-[(6-bromo-1,3-benzothiazol-2-yl)diazenyl]-3-methyl-N,N-dipropylaniline.
| Compound Name | 4-[(6-bromo-1,3-benzothiazol-2-yl)diazenyl]-3-methyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 18737351 |
| Molecular Formula | C20H23BrN4S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-[(6-bromo-1,3-benzothiazol-2-yl)diazenyl]-3-methyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(/N=N/c2nc3ccc(Br)cc3s2)c(C)c1 |
| InChI | InChI=1S/C20H23BrN4S/c1-4-10-25(11-5-2)16-7-9-17(14(3)12-16)23-24-20-22-18-8-6-15(21)13-19(18)26-20/h6-9,12-13H,4-5,10-11H2,1-3H3/b24-23+ |
| InChIKey | ZSISKPUZKDLQNM-WCWDXBQESA-N |
| XLogP | 7.41 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|