C20H24N4O4S2 — CID 152909800
3-[4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-3-methylanilino]propyl methyl sulfate (PubChem CID 152909800) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-3-methylanilino]propyl methyl sulfate.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-3-methylanilino]propyl methyl sulfate |
|---|---|
| PubChem CID | 152909800 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yldiazenyl)-N-ethyl-3-methylanilino]propyl methyl sulfate |
| SMILES | CCN(CCCOS(=O)(=O)OC)c1ccc(/N=N/c2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C20H24N4O4S2/c1-4-24(12-7-13-28-30(25,26)27-3)16-10-11-17(15(2)14-16)22-23-20-21-18-8-5-6-9-19(18)29-20/h5-6,8-11,14H,4,7,12-13H2,1-3H3/b23-22+ |
| InChIKey | UGYWEUSTGINKDQ-GHVJWSGMSA-N |
| XLogP | 5.14 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|