C13H17N5O4S2 — CID 160582178
2-[N,3-dimethyl-4-(1,2,4-thiadiazol-5-yldiazenyl)anilino]ethyl methyl sulfate (PubChem CID 160582178) has the molecular formula C13H17N5O4S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[N,3-dimethyl-4-(1,2,4-thiadiazol-5-yldiazenyl)anilino]ethyl methyl sulfate.
| Compound Name | 2-[N,3-dimethyl-4-(1,2,4-thiadiazol-5-yldiazenyl)anilino]ethyl methyl sulfate |
|---|---|
| PubChem CID | 160582178 |
| Molecular Formula | C13H17N5O4S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-[N,3-dimethyl-4-(1,2,4-thiadiazol-5-yldiazenyl)anilino]ethyl methyl sulfate |
| SMILES | COS(=O)(=O)OCCN(C)c1ccc(/N=N/c2ncns2)c(C)c1 |
| InChI | InChI=1S/C13H17N5O4S2/c1-10-8-11(18(2)6-7-22-24(19,20)21-3)4-5-12(10)16-17-13-14-9-15-23-13/h4-5,8-9H,6-7H2,1-3H3/b17-16+ |
| InChIKey | RBXRMNRUMXYTBD-WUKNDPDISA-N |
| XLogP | 2.61 |
| TPSA | 106.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|