C15H22N6O4S — CID 162055077
3-[N-ethyl-3-methyl-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]propyl methyl sulfate (PubChem CID 162055077) has the molecular formula C15H22N6O4S and a molecular weight of 382.45 g/mol. Its IUPAC name is 3-[N-ethyl-3-methyl-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]propyl methyl sulfate.
| Compound Name | 3-[N-ethyl-3-methyl-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]propyl methyl sulfate |
|---|---|
| PubChem CID | 162055077 |
| Molecular Formula | C15H22N6O4S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-[N-ethyl-3-methyl-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]propyl methyl sulfate |
| SMILES | CCN(CCCOS(=O)(=O)OC)c1ccc(/N=N/c2ncn[nH]2)c(C)c1 |
| InChI | InChI=1S/C15H22N6O4S/c1-4-21(8-5-9-25-26(22,23)24-3)13-6-7-14(12(2)10-13)18-20-15-16-11-17-19-15/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,16,17,19)/b20-18+ |
| InChIKey | YZBJYFULPDJOSE-CZIZESTLSA-N |
| XLogP | 2.65 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|