C19H26N6 — CID 20650631
5-[[4-(dipropylamino)-2-methylphenyl]diazenyl]-3-ethylimidazole-4-carbonitrile (PubChem CID 20650631) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is 5-[[4-(dipropylamino)-2-methylphenyl]diazenyl]-3-ethylimidazole-4-carbonitrile.
| Compound Name | 5-[[4-(dipropylamino)-2-methylphenyl]diazenyl]-3-ethylimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 20650631 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 5-[[4-(dipropylamino)-2-methylphenyl]diazenyl]-3-ethylimidazole-4-carbonitrile |
| SMILES | CCCN(CCC)c1ccc(/N=N/c2ncn(CC)c2C#N)c(C)c1 |
| InChI | InChI=1S/C19H26N6/c1-5-10-25(11-6-2)16-8-9-17(15(4)12-16)22-23-19-18(13-20)24(7-3)14-21-19/h8-9,12,14H,5-7,10-11H2,1-4H3/b23-22+ |
| InChIKey | YNSUHJLVPKAEDJ-GHVJWSGMSA-N |
| XLogP | 5.12 |
| TPSA | 69.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|