C12H20N3O+ — CID 135608509
[4-(dipropylamino)-2-hydroxyphenyl]iminoazanium (PubChem CID 135608509) has the molecular formula C12H20N3O+ and a molecular weight of 222.31 g/mol. Its IUPAC name is [4-(dipropylamino)-2-hydroxyphenyl]iminoazanium.
| Compound Name | [4-(dipropylamino)-2-hydroxyphenyl]iminoazanium |
|---|---|
| PubChem CID | 135608509 |
| Molecular Formula | C12H20N3O+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | [4-(dipropylamino)-2-hydroxyphenyl]iminoazanium |
| SMILES | CCCN(CCC)c1ccc(N=[NH2+])c(O)c1 |
| InChI | InChI=1S/C12H19N3O/c1-3-7-15(8-4-2)10-5-6-11(14-13)12(16)9-10/h5-6,9,13,16H,3-4,7-8H2,1-2H3/p+1 |
| InChIKey | FQQWDCGXCTXJJW-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|