C34H52N3O4+ — CID 176885804
3-[4-[3-[4-(dipropylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]-3-hydroxy-N-propylanilino]propyl-triethylazanium (PubChem CID 176885804) has the molecular formula C34H52N3O4+ and a molecular weight of 566.81 g/mol. Its IUPAC name is 3-[4-[3-[4-(dipropylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]-3-hydroxy-N-propylanilino]propyl-triethylazanium.
| Compound Name | 3-[4-[3-[4-(dipropylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]-3-hydroxy-N-propylanilino]propyl-triethylazanium |
|---|---|
| PubChem CID | 176885804 |
| Molecular Formula | C34H52N3O4+ |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | 3-[4-[3-[4-(dipropylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]-3-hydroxy-N-propylanilino]propyl-triethylazanium |
| SMILES | CCCN(CCC)c1ccc(C2=C(O)C(c3ccc(N(CCC)CCC[N+](CC)(CC)CC)cc3O)=C2O)c(O)c1 |
| InChI | InChI=1S/C34H51N3O4/c1-7-18-35(19-8-2)25-14-16-27(29(38)23-25)31-33(40)32(34(31)41)28-17-15-26(24-30(28)39)36(20-9-3)21-13-22-37(10-4,11-5)12-6/h14-17,23-24H,7-13,18-22H2,1-6H3,(H3-,38,39,40,41)/p+1 |
| InChIKey | JSPJKJVCXFOTKN-UHFFFAOYSA-O |
| XLogP | 7.46 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|