C39H59N3O4S2 — CID 122233576
2-[5-(dibutylamino)-2-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]phenoxy]ethyl N,N-diethylcarbamodithioate (PubChem CID 122233576) has the molecular formula C39H59N3O4S2 and a molecular weight of 698.05 g/mol. Its IUPAC name is 2-[5-(dibutylamino)-2-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]phenoxy]ethyl N,N-diethylcarbamodithioate.
| Compound Name | 2-[5-(dibutylamino)-2-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]phenoxy]ethyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 122233576 |
| Molecular Formula | C39H59N3O4S2 |
| Molecular Weight | 698.05 g/mol |
| Exact Mass | 697.39 |
| IUPAC Name | 2-[5-(dibutylamino)-2-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2,4-dihydroxycyclobuta-1,3-dien-1-yl]phenoxy]ethyl N,N-diethylcarbamodithioate |
| SMILES | CCCCN(CCCC)c1ccc(C2=C(O)C(c3ccc(N(CCCC)CCCC)cc3OCCSC(=S)N(CC)CC)=C2O)c(O)c1 |
| InChI | InChI=1S/C39H59N3O4S2/c1-7-13-21-41(22-14-8-2)29-17-19-31(33(43)27-29)35-37(44)36(38(35)45)32-20-18-30(42(23-15-9-3)24-16-10-4)28-34(32)46-25-26-48-39(47)40(11-5)12-6/h17-20,27-28,43-45H,7-16,21-26H2,1-6H3 |
| InChIKey | VOSYTRPGQGKDFH-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.05 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|