C32H44N2O3S — CID 177401248
(6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-4-oxo-2-sulfanylcyclobut-2-en-1-ylidene]cyclohexa-2,4-dien-1-one (PubChem CID 177401248) has the molecular formula C32H44N2O3S and a molecular weight of 536.78 g/mol. Its IUPAC name is (6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-4-oxo-2-sulfanylcyclobut-2-en-1-ylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | (6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-4-oxo-2-sulfanylcyclobut-2-en-1-ylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 177401248 |
| Molecular Formula | C32H44N2O3S |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | (6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-4-oxo-2-sulfanylcyclobut-2-en-1-ylidene]cyclohexa-2,4-dien-1-one |
| SMILES | CCCCN(CCCC)C1=CC(=O)/C(=C2/C(=O)C(c3ccc(N(CCCC)CCCC)cc3O)=C2S)C=C1 |
| InChI | InChI=1S/C32H44N2O3S/c1-5-9-17-33(18-10-6-2)23-13-15-25(27(35)21-23)29-31(37)30(32(29)38)26-16-14-24(22-28(26)36)34(19-11-7-3)20-12-8-4/h13-16,21-22,35,38H,5-12,17-20H2,1-4H3/b30-26- |
| InChIKey | JRQNXPSETHMKCT-BXVZCJGGSA-N |
| XLogP | 7.24 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|