C32H44N2O6 — CID 155648526
(6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-5-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 155648526) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is (6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-5-hydroxycyclohexa-2,4-dien-1-one.
| Compound Name | (6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-5-hydroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 155648526 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | (6Z)-3-(dibutylamino)-6-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-5-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | CCCCN(CCCC)C1=CC(=O)/C(=C2\C(=O)C(c3c(O)cc(N(CCCC)CCCC)cc3O)=C2O)C(O)=C1 |
| InChI | InChI=1S/C32H44N2O6/c1-5-9-13-33(14-10-6-2)21-17-23(35)27(24(36)18-21)29-31(39)30(32(29)40)28-25(37)19-22(20-26(28)38)34(15-11-7-3)16-12-8-4/h17-20,35-37,39H,5-16H2,1-4H3/b30-28- |
| InChIKey | LPMLDNLDGATUGU-HYOGKJQXSA-N |
| XLogP | 6.46 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|