C32H45N2O6+ — CID 146301706
dibutyl-[4-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 146301706) has the molecular formula C32H45N2O6+ and a molecular weight of 553.72 g/mol. Its IUPAC name is dibutyl-[4-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | dibutyl-[4-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 146301706 |
| Molecular Formula | C32H45N2O6+ |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | dibutyl-[4-[3-[4-(dibutylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CCCCN(CCCC)c1cc(O)c(C2=C(O)C(=C3C(O)=CC(=[N+](CCCC)CCCC)C=C3O)C2=O)c(O)c1 |
| InChI | InChI=1S/C32H44N2O6/c1-5-9-13-33(14-10-6-2)21-17-23(35)27(24(36)18-21)29-31(39)30(32(29)40)28-25(37)19-22(20-26(28)38)34(15-11-7-3)16-12-8-4/h17-20H,5-16H2,1-4H3,(H4,35,36,37,38,39,40)/p+1 |
| InChIKey | HLJJBSZIPRLLSC-UHFFFAOYSA-O |
| XLogP | 6.60 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|