C36H46N3O2S+ — CID 102139432
[4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-[2-[2-(N-methylanilino)ethylsulfanyl]ethyl]azanium (PubChem CID 102139432) has the molecular formula C36H46N3O2S+ and a molecular weight of 584.85 g/mol. Its IUPAC name is [4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-[2-[2-(N-methylanilino)ethylsulfanyl]ethyl]azanium.
| Compound Name | [4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-[2-[2-(N-methylanilino)ethylsulfanyl]ethyl]azanium |
|---|---|
| PubChem CID | 102139432 |
| Molecular Formula | C36H46N3O2S+ |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | [4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-[2-[2-(N-methylanilino)ethylsulfanyl]ethyl]azanium |
| SMILES | CCCCN(CCCC)c1ccc(C2=C(O)C(=C3C=CC(=[N+](C)CCSCCN(C)c4ccccc4)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C36H45N3O2S/c1-5-7-22-39(23-8-6-2)32-20-16-29(17-21-32)34-35(40)33(36(34)41)28-14-18-31(19-15-28)38(4)25-27-42-26-24-37(3)30-12-10-9-11-13-30/h9-21H,5-8,22-27H2,1-4H3/p+1 |
| InChIKey | QPGRKCVXOFYWQU-UHFFFAOYSA-O |
| XLogP | 7.32 |
| TPSA | 46.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|