C41H47N6O4+ — CID 134940015
[4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]-methylazanium (PubChem CID 134940015) has the molecular formula C41H47N6O4+ and a molecular weight of 687.87 g/mol. Its IUPAC name is [4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]-methylazanium.
| Compound Name | [4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]-methylazanium |
|---|---|
| PubChem CID | 134940015 |
| Molecular Formula | C41H47N6O4+ |
| Molecular Weight | 687.87 g/mol |
| Exact Mass | 687.37 |
| IUPAC Name | [4-[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl]-methylazanium |
| SMILES | CCCCN(CCCC)c1ccc(C2=C(O)C(=C3C=CC(=[N+](C)CCN(CC)c4ccc(/N=N/c5ccc([N+](=O)[O-])cc5)cc4)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C41H46N6O4/c1-5-8-26-46(27-9-6-2)36-20-12-31(13-21-36)39-40(48)38(41(39)49)30-10-18-34(19-11-30)44(4)28-29-45(7-3)35-22-14-32(15-23-35)42-43-33-16-24-37(25-17-33)47(50)51/h10-25H,5-9,26-29H2,1-4H3/p+1/b43-42+ |
| InChIKey | OBWZZEPZOFCVTO-HBSCQBRPSA-O |
| XLogP | 9.30 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.87 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|