C33H45N2O7S+ — CID 158041117
butyl-[4-[3-[4-[butyl(3-sulfopropyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-ethoxy-4-oxobutyl)azanium (PubChem CID 158041117) has the molecular formula C33H45N2O7S+ and a molecular weight of 613.80 g/mol. Its IUPAC name is butyl-[4-[3-[4-[butyl(3-sulfopropyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-ethoxy-4-oxobutyl)azanium.
| Compound Name | butyl-[4-[3-[4-[butyl(3-sulfopropyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-ethoxy-4-oxobutyl)azanium |
|---|---|
| PubChem CID | 158041117 |
| Molecular Formula | C33H45N2O7S+ |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | butyl-[4-[3-[4-[butyl(3-sulfopropyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-ethoxy-4-oxobutyl)azanium |
| SMILES | CCCCN(CCCS(=O)(=O)O)c1ccc(C2=C(O)C(=C3C=CC(=[N+](CCCC)CCCC(=O)OCC)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C33H44N2O7S/c1-4-7-20-34(22-9-11-29(36)42-6-3)27-16-12-25(13-17-27)30-32(37)31(33(30)38)26-14-18-28(19-15-26)35(21-8-5-2)23-10-24-43(39,40)41/h12-19H,4-11,20-24H2,1-3H3,(H-,37,38,39,40,41)/p+1 |
| InChIKey | IVQBBZRCWUCYON-UHFFFAOYSA-O |
| XLogP | 5.44 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|