C35H48N2O3S — CID 135133894
4-[[4-(dibutylamino)phenyl]-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate (PubChem CID 135133894) has the molecular formula C35H48N2O3S and a molecular weight of 576.85 g/mol. Its IUPAC name is 4-[[4-(dibutylamino)phenyl]-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate.
| Compound Name | 4-[[4-(dibutylamino)phenyl]-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 135133894 |
| Molecular Formula | C35H48N2O3S |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 576.34 |
| IUPAC Name | 4-[[4-(dibutylamino)phenyl]-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
| SMILES | CCCCN(CCCC)c1ccc(C(=C2C=CC(=[N+](CCCC)CCCC)C=C2)c2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C35H48N2O3S/c1-5-9-25-36(26-10-6-2)32-19-13-29(14-20-32)35(31-17-23-34(24-18-31)41(38,39)40)30-15-21-33(22-16-30)37(27-11-7-3)28-12-8-4/h13-24H,5-12,25-28H2,1-4H3 |
| InChIKey | RSHBVXDSCYVUFI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|