C35H48N3O2+ — CID 135133875
dibutyl-[4-[[4-(dibutylamino)phenyl]-(2-nitrophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 135133875) has the molecular formula C35H48N3O2+ and a molecular weight of 542.79 g/mol. Its IUPAC name is dibutyl-[4-[[4-(dibutylamino)phenyl]-(2-nitrophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | dibutyl-[4-[[4-(dibutylamino)phenyl]-(2-nitrophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 135133875 |
| Molecular Formula | C35H48N3O2+ |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | dibutyl-[4-[[4-(dibutylamino)phenyl]-(2-nitrophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CCCCN(CCCC)c1ccc(C(=C2C=CC(=[N+](CCCC)CCCC)C=C2)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H48N3O2/c1-5-9-25-36(26-10-6-2)31-21-17-29(18-22-31)35(33-15-13-14-16-34(33)38(39)40)30-19-23-32(24-20-30)37(27-11-7-3)28-12-8-4/h13-24H,5-12,25-28H2,1-4H3/q+1 |
| InChIKey | IFUGPRLLWTZLFG-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|