C31H42N3O6+ — CID 59057711
[4-[bis[4-[bis(2-hydroxyethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium (PubChem CID 59057711) has the molecular formula C31H42N3O6+ and a molecular weight of 552.69 g/mol. Its IUPAC name is [4-[bis[4-[bis(2-hydroxyethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium.
| Compound Name | [4-[bis[4-[bis(2-hydroxyethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 59057711 |
| Molecular Formula | C31H42N3O6+ |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | [4-[bis[4-[bis(2-hydroxyethyl)amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium |
| SMILES | OCCN(CCO)c1ccc(C(=C2C=CC(=[N+](CCO)CCO)C=C2)c2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C31H42N3O6/c35-19-13-32(14-20-36)28-7-1-25(2-8-28)31(26-3-9-29(10-4-26)33(15-21-37)16-22-38)27-5-11-30(12-6-27)34(17-23-39)18-24-40/h1-12,35-40H,13-24H2/q+1 |
| InChIKey | NKCHWVINQNLHRD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|