C27H33N2O7S+ — CID 59722344
[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium (PubChem CID 59722344) has the molecular formula C27H33N2O7S+ and a molecular weight of 529.64 g/mol. Its IUPAC name is [4-[[4-[bis(2-hydroxyethyl)amino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium.
| Compound Name | [4-[[4-[bis(2-hydroxyethyl)amino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 59722344 |
| Molecular Formula | C27H33N2O7S+ |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [4-[[4-[bis(2-hydroxyethyl)amino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium |
| SMILES | O=S(=O)(O)c1ccccc1C(=C1C=CC(=[N+](CCO)CCO)C=C1)c1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C27H32N2O7S/c30-17-13-28(14-18-31)23-9-5-21(6-10-23)27(25-3-1-2-4-26(25)37(34,35)36)22-7-11-24(12-8-22)29(15-19-32)16-20-33/h1-12,30-33H,13-20H2/p+1 |
| InChIKey | JPKFDHUWKIVXLK-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|