C43H49N2O3S+ — CID 158976094
butyl-[4-[[4-(N-butyl-2,6-dimethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,6-dimethylphenyl)azanium (PubChem CID 158976094) has the molecular formula C43H49N2O3S+ and a molecular weight of 673.94 g/mol. Its IUPAC name is butyl-[4-[[4-(N-butyl-2,6-dimethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,6-dimethylphenyl)azanium.
| Compound Name | butyl-[4-[[4-(N-butyl-2,6-dimethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,6-dimethylphenyl)azanium |
|---|---|
| PubChem CID | 158976094 |
| Molecular Formula | C43H49N2O3S+ |
| Molecular Weight | 673.94 g/mol |
| Exact Mass | 673.35 |
| IUPAC Name | butyl-[4-[[4-(N-butyl-2,6-dimethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(2,6-dimethylphenyl)azanium |
| SMILES | CCCCN(c1ccc(C(=C2C=CC(=[N+](CCCC)c3c(C)cccc3C)C=C2)c2ccccc2S(=O)(=O)O)cc1)c1c(C)cccc1C |
| InChI | InChI=1S/C43H48N2O3S/c1-7-9-29-44(42-31(3)15-13-16-32(42)4)37-25-21-35(22-26-37)41(39-19-11-12-20-40(39)49(46,47)48)36-23-27-38(28-24-36)45(30-10-8-2)43-33(5)17-14-18-34(43)6/h11-28H,7-10,29-30H2,1-6H3/p+1 |
| InChIKey | FCVVYYAGCIARFZ-UHFFFAOYSA-O |
| XLogP | 10.62 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.94 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|