C35H33N2O3S+ — CID 159223784
ethyl-[4-[[4-(N-ethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-phenylazanium (PubChem CID 159223784) has the molecular formula C35H33N2O3S+ and a molecular weight of 561.73 g/mol. Its IUPAC name is ethyl-[4-[[4-(N-ethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-phenylazanium.
| Compound Name | ethyl-[4-[[4-(N-ethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-phenylazanium |
|---|---|
| PubChem CID | 159223784 |
| Molecular Formula | C35H33N2O3S+ |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | ethyl-[4-[[4-(N-ethylanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-phenylazanium |
| SMILES | CCN(c1ccccc1)c1ccc(C(=C2C=CC(=[N+](CC)c3ccccc3)C=C2)c2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C35H32N2O3S/c1-3-36(29-13-7-5-8-14-29)31-23-19-27(20-24-31)35(33-17-11-12-18-34(33)41(38,39)40)28-21-25-32(26-22-28)37(4-2)30-15-9-6-10-16-30/h5-26H,3-4H2,1-2H3/p+1 |
| InChIKey | ZNXPCQGZRCHWGB-UHFFFAOYSA-O |
| XLogP | 7.82 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|