C34H33N2O2+ — CID 69131411
diethyl-[4-[[4-(N-ethylanilino)phenyl]-(4-oxochromen-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 69131411) has the molecular formula C34H33N2O2+ and a molecular weight of 501.65 g/mol. Its IUPAC name is diethyl-[4-[[4-(N-ethylanilino)phenyl]-(4-oxochromen-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | diethyl-[4-[[4-(N-ethylanilino)phenyl]-(4-oxochromen-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 69131411 |
| Molecular Formula | C34H33N2O2+ |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | diethyl-[4-[[4-(N-ethylanilino)phenyl]-(4-oxochromen-3-yl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CCN(c1ccccc1)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2coc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C34H33N2O2/c1-4-35(5-2)27-20-16-25(17-21-27)33(31-24-38-32-15-11-10-14-30(32)34(31)37)26-18-22-29(23-19-26)36(6-3)28-12-8-7-9-13-28/h7-24H,4-6H2,1-3H3/q+1 |
| InChIKey | HKKBQDFORLVFGE-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 36.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|