About benzene;3-hydroxychromen-4-one
benzene;3-hydroxychromen-4-one (PubChem CID 175480795) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is benzene;3-hydroxychromen-4-one.
Molecular Properties
| Compound Name | benzene;3-hydroxychromen-4-one |
| PubChem CID | 175480795 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | benzene;3-hydroxychromen-4-one |
| SMILES | O=c1c(O)coc2ccccc12.c1ccccc1 |
| InChI | InChI=1S/C9H6O3.C6H6/c10-7-5-12-8-4-2-1-3-6(8)9(7)11;1-2-4-6-5-3-1/h1-5,10H;1-6H |
| InChIKey | CYAIDLKBGGZQJC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;3-hydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-hydroxychromen-4-one?
The IUPAC name of benzene;3-hydroxychromen-4-one (CID 175480795) is benzene;3-hydroxychromen-4-one.
What is the SMILES notation for benzene;3-hydroxychromen-4-one?
The canonical SMILES for benzene;3-hydroxychromen-4-one is O=c1c(O)coc2ccccc12.c1ccccc1.
What is the InChIKey of benzene;3-hydroxychromen-4-one?
The InChIKey is CYAIDLKBGGZQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3.C6H6/c10-7-5-12-8-4-2-1-3-6(8)9(7)11;1-2-4-6-5-3-1/h1-5,10H;1-6H.
What are the key properties of benzene;3-hydroxychromen-4-one?
benzene;3-hydroxychromen-4-one has a molecular weight of 240.26 g/mol, XLogP of 3.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-hydroxychromen-4-one is sourced from PubChem (CID 175480795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).