C17H12O4 — CID 102368296
3-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]chromen-4-one (PubChem CID 102368296) has the molecular formula C17H12O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]chromen-4-one.
| Compound Name | 3-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]chromen-4-one |
|---|---|
| PubChem CID | 102368296 |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]chromen-4-one |
| SMILES | O=c1c(/C=C/c2ccc(O)c(O)c2)coc2ccccc12 |
| InChI | InChI=1S/C17H12O4/c18-14-8-6-11(9-15(14)19)5-7-12-10-21-16-4-2-1-3-13(16)17(12)20/h1-10,18-19H/b7-5+ |
| InChIKey | WCWATWTXZVFWSG-FNORWQNLSA-N |
| XLogP | 3.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|