C18H15N3O3 — CID 108805807
(E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108805807) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108805807 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | Cc1cc(C)nc(NC(=O)/C=C/c2coc3ccccc3c2=O)n1 |
| InChI | InChI=1S/C18H15N3O3/c1-11-9-12(2)20-18(19-11)21-16(22)8-7-13-10-24-15-6-4-3-5-14(15)17(13)23/h3-10H,1-2H3,(H,19,20,21,22)/b8-7+ |
| InChIKey | NPFOCYGSSDGLAK-BQYQJAHWSA-N |
| XLogP | 2.85 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|