C24H19N3O4 — CID 108742529
(E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108742529) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is (E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108742529 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | Cc1cc(C)nc(Oc2ccc(NC(=O)/C=C/c3coc4ccccc4c3=O)cc2)n1 |
| InChI | InChI=1S/C24H19N3O4/c1-15-13-16(2)26-24(25-15)31-19-10-8-18(9-11-19)27-22(28)12-7-17-14-30-21-6-4-3-5-20(21)23(17)29/h3-14H,1-2H3,(H,27,28)/b12-7+ |
| InChIKey | FHKGUKKTILTOTL-KPKJPENVSA-N |
| XLogP | 4.64 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|