C19H17N3O4S — CID 108805886
N,N,4-trimethyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 108805886) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 108805886 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N,N,4-trimethyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)/C=C/c2coc3ccccc3c2=O)sc1C(=O)N(C)C |
| InChI | InChI=1S/C19H17N3O4S/c1-11-17(18(25)22(2)3)27-19(20-11)21-15(23)9-8-12-10-26-14-7-5-4-6-13(14)16(12)24/h4-10H,1-3H3,(H,20,21,23)/b9-8+ |
| InChIKey | GKXPTYNMMWGCMN-CMDGGOBGSA-N |
| XLogP | 2.91 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|