C24H19N3O4S — CID 108739801
(E)-N-[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108739801) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is (E)-N-[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108739801 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (E)-N-[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)/C=C/c3coc4ccccc4c3=O)n2)cc1 |
| InChI | InChI=1S/C24H19N3O4S/c1-15(28)25-12-16-6-8-17(9-7-16)20-14-32-24(26-20)27-22(29)11-10-18-13-31-21-5-3-2-4-19(21)23(18)30/h2-11,13-14H,12H2,1H3,(H,25,28)(H,26,27,29)/b11-10+ |
| InChIKey | LNVBUAJKWNREAV-ZHACJKMWSA-N |
| XLogP | 4.20 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|