C27H18N2O3S — CID 108727461
(E)-3-(4-oxochromen-3-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide (PubChem CID 108727461) has the molecular formula C27H18N2O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is (E)-3-(4-oxochromen-3-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-oxochromen-3-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108727461 |
| Molecular Formula | C27H18N2O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (E)-3-(4-oxochromen-3-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)Nc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H18N2O3S/c30-25(15-12-20-16-32-24-9-5-4-8-22(24)26(20)31)28-21-13-10-18(11-14-21)23-17-33-27(29-23)19-6-2-1-3-7-19/h1-17H,(H,28,30)/b15-12+ |
| InChIKey | RXWGVOCYTANMDT-NTCAYCPXSA-N |
| XLogP | 6.24 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|