C22H15N3O4 — CID 108747825
(E)-3-(4-oxochromen-3-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]prop-2-enamide (PubChem CID 108747825) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is (E)-3-(4-oxochromen-3-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-oxochromen-3-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108747825 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (E)-3-(4-oxochromen-3-yl)-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)Nc1cccc(-c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C22H15N3O4/c26-20(10-8-15-13-29-19-7-2-1-6-17(19)22(15)28)23-16-5-3-4-14(12-16)18-9-11-21(27)25-24-18/h1-13H,(H,23,26)(H,25,27)/b10-8+ |
| InChIKey | BUSPRAZJNRDOJT-CSKARUKUSA-N |
| XLogP | 3.20 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|