C23H18N2O3S — CID 108737693
(E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108737693) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is (E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108737693 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)NCc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C23H18N2O3S/c26-21(11-10-17-14-28-20-9-5-4-8-19(20)23(17)27)24-13-18-15-29-22(25-18)12-16-6-2-1-3-7-16/h1-11,14-15H,12-13H2,(H,24,26)/b11-10+ |
| InChIKey | BCTZSUOSSRYDRI-ZHACJKMWSA-N |
| XLogP | 4.17 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|