C24H18N2O5S — CID 108794153
benzyl 4-methyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 108794153) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is benzyl 4-methyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | benzyl 4-methyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 108794153 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | benzyl 4-methyl-2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(NC(=O)/C=C/c2coc3ccccc3c2=O)sc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H18N2O5S/c1-15-22(23(29)31-13-16-7-3-2-4-8-16)32-24(25-15)26-20(27)12-11-17-14-30-19-10-6-5-9-18(19)21(17)28/h2-12,14H,13H2,1H3,(H,25,26,27)/b12-11+ |
| InChIKey | JSYWBLZDRVQHRA-VAWYXSNFSA-N |
| XLogP | 4.57 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|