C22H16N2O5S — CID 108739232
ethyl 2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 108739232) has the molecular formula C22H16N2O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 108739232 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | ethyl 2-[[(E)-3-(4-oxochromen-3-yl)prop-2-enoyl]amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)/C=C/c3coc4ccccc4c3=O)sc2c1 |
| InChI | InChI=1S/C22H16N2O5S/c1-2-28-21(27)13-7-9-16-18(11-13)30-22(23-16)24-19(25)10-8-14-12-29-17-6-4-3-5-15(17)20(14)26/h3-12H,2H2,1H3,(H,23,24,25)/b10-8+ |
| InChIKey | HSOOJYWEBMCSJV-CSKARUKUSA-N |
| XLogP | 4.23 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|