C17H15N3O2S2 — CID 108782597
ethyl 2-(phenylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 108782597) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is ethyl 2-(phenylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(phenylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 108782597 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | ethyl 2-(phenylcarbamothioylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=S)Nc3ccccc3)sc2c1 |
| InChI | InChI=1S/C17H15N3O2S2/c1-2-22-15(21)11-8-9-13-14(10-11)24-17(19-13)20-16(23)18-12-6-4-3-5-7-12/h3-10H,2H2,1H3,(H2,18,19,20,23) |
| InChIKey | GPBMKRQQPGKKDE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|