C17H20N2O3S — CID 110442130
benzyl 4-methyl-2-(3-methylbutanoylamino)-1,3-thiazole-5-carboxylate (PubChem CID 110442130) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is benzyl 4-methyl-2-(3-methylbutanoylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | benzyl 4-methyl-2-(3-methylbutanoylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110442130 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | benzyl 4-methyl-2-(3-methylbutanoylamino)-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(NC(=O)CC(C)C)sc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-11(2)9-14(20)19-17-18-12(3)15(23-17)16(21)22-10-13-7-5-4-6-8-13/h4-8,11H,9-10H2,1-3H3,(H,18,19,20) |
| InChIKey | ROXKPNNTADJNSC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |