C19H15ClFN3O2S2 — CID 21008666
benzyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 21008666) has the molecular formula C19H15ClFN3O2S2 and a molecular weight of 435.93 g/mol. Its IUPAC name is benzyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | benzyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 21008666 |
| Molecular Formula | C19H15ClFN3O2S2 |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | benzyl 2-[(3-chloro-4-fluorophenyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(NC(=S)Nc2ccc(F)c(Cl)c2)sc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H15ClFN3O2S2/c1-11-16(17(25)26-10-12-5-3-2-4-6-12)28-19(22-11)24-18(27)23-13-7-8-15(21)14(20)9-13/h2-9H,10H2,1H3,(H2,22,23,24,27) |
| InChIKey | OWSJJPDEKDUBDJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|