C18H21NO4 — CID 108805840
(E)-N-(6-hydroxyhexyl)-3-(4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108805840) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (E)-N-(6-hydroxyhexyl)-3-(4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(6-hydroxyhexyl)-3-(4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108805840 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (E)-N-(6-hydroxyhexyl)-3-(4-oxochromen-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)NCCCCCCO |
| InChI | InChI=1S/C18H21NO4/c20-12-6-2-1-5-11-19-17(21)10-9-14-13-23-16-8-4-3-7-15(16)18(14)22/h3-4,7-10,13,20H,1-2,5-6,11-12H2,(H,19,21)/b10-9+ |
| InChIKey | OYDFRXFFFBDAJI-MDZDMXLPSA-N |
| XLogP | 2.48 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|