C16H16FN3O2S — CID 844544
2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 844544) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 844544 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)/C=C/c2ccc(F)cc2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C16H16FN3O2S/c1-10-14(15(22)20(2)3)23-16(18-10)19-13(21)9-6-11-4-7-12(17)8-5-11/h4-9H,1-3H3,(H,18,19,21)/b9-6+ |
| InChIKey | QDLCRNNSHOZPFC-RMKNXTFCSA-N |
| XLogP | 2.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|