C15H13FN2OS — CID 47119070
(E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 47119070) has the molecular formula C15H13FN2OS and a molecular weight of 288.35 g/mol. Its IUPAC name is (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 47119070 |
| Molecular Formula | C15H13FN2OS |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C15H13FN2OS/c16-11-7-4-10(5-8-11)6-9-14(19)18-15-17-12-2-1-3-13(12)20-15/h4-9H,1-3H2,(H,17,18,19)/b9-6+ |
| InChIKey | STXPKVKGEWAVKT-RMKNXTFCSA-N |
| XLogP | 3.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|