C22H20N2O2S — CID 84559178
(E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 84559178) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 84559178 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-3-(3-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(OCc2ccccc2)c1)Nc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C22H20N2O2S/c25-21(24-22-23-19-10-5-11-20(19)27-22)13-12-16-8-4-9-18(14-16)26-15-17-6-2-1-3-7-17/h1-4,6-9,12-14H,5,10-11,15H2,(H,23,24,25)/b13-12+ |
| InChIKey | FTFZBWWEKJBHOV-OUKQBFOZSA-N |
| XLogP | 4.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|