C15H12Cl2N2OS — CID 84559967
(E)-3-(2,4-dichlorophenyl)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)prop-2-enamide (PubChem CID 84559967) has the molecular formula C15H12Cl2N2OS and a molecular weight of 339.25 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 84559967 |
| Molecular Formula | C15H12Cl2N2OS |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C15H12Cl2N2OS/c16-10-6-4-9(11(17)8-10)5-7-14(20)19-15-18-12-2-1-3-13(12)21-15/h4-8H,1-3H2,(H,18,19,20)/b7-5+ |
| InChIKey | JXDSRJYCHFJKQB-FNORWQNLSA-N |
| XLogP | 4.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|