About CID 143974471
CID 143974471 (PubChem CID 143974471) has the molecular formula C9H5AlO2
and a molecular weight of 172.12 g/mol.
Molecular Properties
| Compound Name | CID 143974471 |
| PubChem CID | 143974471 |
| Molecular Formula | C9H5AlO2 |
| Molecular Weight | 172.12 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | — |
| SMILES | O=c1c([Al])coc2ccccc12 |
| InChI | InChI=1S/C9H5O2.Al/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-4,6H; |
| InChIKey | SCLYUHVKQGESBZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 143974471 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143974471?
The IUPAC name of CID 143974471 (CID 143974471) is not available.
What is the SMILES notation for CID 143974471?
The canonical SMILES for CID 143974471 is O=c1c([Al])coc2ccccc12.
What is the InChIKey of CID 143974471?
The InChIKey is SCLYUHVKQGESBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5O2.Al/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-4,6H;.
What are the key properties of CID 143974471?
CID 143974471 has a molecular weight of 172.12 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143974471 is sourced from PubChem (CID 143974471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).