C13H12O4 — CID 102496487
3-(2-methyl-1,3-dioxolan-2-yl)chromen-4-one (PubChem CID 102496487) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dioxolan-2-yl)chromen-4-one.
| Compound Name | 3-(2-methyl-1,3-dioxolan-2-yl)chromen-4-one |
|---|---|
| PubChem CID | 102496487 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(2-methyl-1,3-dioxolan-2-yl)chromen-4-one |
| SMILES | CC1(c2coc3ccccc3c2=O)OCCO1 |
| InChI | InChI=1S/C13H12O4/c1-13(16-6-7-17-13)10-8-15-11-5-3-2-4-9(11)12(10)14/h2-5,8H,6-7H2,1H3 |
| InChIKey | DCFVGUVKASFIGO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |