C22H20NO2+ — CID 12067592
3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromen-4-one (PubChem CID 12067592) has the molecular formula C22H20NO2+ and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromen-4-one.
| Compound Name | 3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromen-4-one |
|---|---|
| PubChem CID | 12067592 |
| Molecular Formula | C22H20NO2+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]chromen-4-one |
| SMILES | C[N+]1=C(/C=C/c2coc3ccccc3c2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H20NO2/c1-22(2)17-9-5-6-10-18(17)23(3)20(22)13-12-15-14-25-19-11-7-4-8-16(19)21(15)24/h4-14H,1-3H3/q+1/b13-12+ |
| InChIKey | IOTSQRNHYUHQOV-OUKQBFOZSA-N |
| XLogP | 4.51 |
| TPSA | 33.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|