C22H24N3+ — CID 123305330
2-methyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]indol-1-amine (PubChem CID 123305330) has the molecular formula C22H24N3+ and a molecular weight of 330.46 g/mol. Its IUPAC name is 2-methyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]indol-1-amine.
| Compound Name | 2-methyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]indol-1-amine |
|---|---|
| PubChem CID | 123305330 |
| Molecular Formula | C22H24N3+ |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-methyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]indol-1-amine |
| SMILES | Cc1c(C=CC2=[N+](C)c3ccccc3C2(C)C)c2ccccc2n1N |
| InChI | InChI=1S/C22H24N3/c1-15-16(17-9-5-7-11-19(17)25(15)23)13-14-21-22(2,3)18-10-6-8-12-20(18)24(21)4/h5-14H,23H2,1-4H3/q+1 |
| InChIKey | PZXNHNHHOOQDCW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|