C19H20NO+ — CID 6012065
2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]phenol (PubChem CID 6012065) has the molecular formula C19H20NO+ and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]phenol.
| Compound Name | 2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 6012065 |
| Molecular Formula | C19H20NO+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]phenol |
| SMILES | C[N+]1=C(/C=C/c2ccccc2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H19NO/c1-19(2)15-9-5-6-10-16(15)20(3)18(19)13-12-14-8-4-7-11-17(14)21/h4-13H,1-3H3/p+1 |
| InChIKey | ZJJDGZLNAPTSBE-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|