C16H22N+ — CID 147182916
1,3,3-trimethyl-2-[(E)-3-methylbut-1-enyl]indol-1-ium (PubChem CID 147182916) has the molecular formula C16H22N+ and a molecular weight of 228.36 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(E)-3-methylbut-1-enyl]indol-1-ium.
| Compound Name | 1,3,3-trimethyl-2-[(E)-3-methylbut-1-enyl]indol-1-ium |
|---|---|
| PubChem CID | 147182916 |
| Molecular Formula | C16H22N+ |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1,3,3-trimethyl-2-[(E)-3-methylbut-1-enyl]indol-1-ium |
| SMILES | CC(C)/C=C/C1=[N+](C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C16H22N/c1-12(2)10-11-15-16(3,4)13-8-6-7-9-14(13)17(15)5/h6-12H,1-5H3/q+1/b11-10+ |
| InChIKey | BZXXQPMVVQDLLR-ZHACJKMWSA-N |
| XLogP | 3.90 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|