C21H24ClNO5 — CID 158630130
2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium perchlorate (PubChem CID 158630130) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium perchlorate.
| Compound Name | 2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium perchlorate |
|---|---|
| PubChem CID | 158630130 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[(E)-3-(2,6-dimethylpyran-4-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium perchlorate |
| SMILES | CC1=CC(=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C=C(C)O1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H24NO.ClHO4/c1-15-13-17(14-16(2)23-15)9-8-12-20-21(3,4)18-10-6-7-11-19(18)22(20)5;2-1(3,4)5/h6-14H,1-5H3;(H,2,3,4,5)/q+1;/p-1/b12-8+; |
| InChIKey | HZBXVPNBVQNROO-MXZHIVQLSA-M |
| XLogP | 0.26 |
| TPSA | 104.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|